C21H25FO5 — CID 118074557
(11S,16R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118074557) has the molecular formula C21H25FO5 and a molecular weight of 376.42 g/mol. Its IUPAC name is (11S,16R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11S,16R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118074557 |
| Molecular Formula | C21H25FO5 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (11S,16R)-9-fluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-13,16-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=C=C4C3(F)[C@@H](O)CC2(C)C1(O)C(=O)CO |
| InChI | InChI=1S/C21H25FO5/c1-11-7-16-15-5-3-12-8-13(24)4-6-14(12)20(15,22)17(25)9-19(16,2)21(11,27)18(26)10-23/h4,8,11,15-17,23,25,27H,3,5,7,9-10H2,1-2H3/t11-,15?,16?,17+,19?,20?,21?/m1/s1 |
| InChIKey | SYUQIMICMDPSOJ-JQEOJVNRSA-N |
| XLogP | 1.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |