About (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine
(2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine (PubChem CID 118074678) has the molecular formula C11H14Br2N2
and a molecular weight of 334.06 g/mol. Its IUPAC name is (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine.
Molecular Properties
| Compound Name | (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine |
| PubChem CID | 118074678 |
| Molecular Formula | C11H14Br2N2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine |
| SMILES | C/C=C\N1C=C(Br)N=C(Br)/C1=C\CCC |
| InChI | InChI=1S/C11H14Br2N2/c1-3-5-6-9-11(13)14-10(12)8-15(9)7-4-2/h4,6-8H,3,5H2,1-2H3/b7-4-,9-6+ |
| InChIKey | QQWCCIAHHXRLIC-WCXGJSBASA-N |
| XLogP | 4.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine?
The IUPAC name of (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine (CID 118074678) is (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine.
What is the SMILES notation for (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine?
The canonical SMILES for (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine is C/C=C\N1C=C(Br)N=C(Br)/C1=C\CCC.
What is the InChIKey of (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine?
The InChIKey is QQWCCIAHHXRLIC-WCXGJSBASA-N. The full InChI is InChI=1S/C11H14Br2N2/c1-3-5-6-9-11(13)14-10(12)8-15(9)7-4-2/h4,6-8H,3,5H2,1-2H3/b7-4-,9-6+.
What are the key properties of (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine?
(2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine has a molecular weight of 334.06 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,5-dibromo-2-butylidene-1-[(Z)-prop-1-enyl]pyrazine is sourced from PubChem (CID 118074678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).