C26H42N4O5 — CID 118074845
(5R,8S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-7-[(2S)-2-(hydroxyamino)-3,3-dimethylbutanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide (PubChem CID 118074845) has the molecular formula C26H42N4O5 and a molecular weight of 490.65 g/mol. Its IUPAC name is (5R,8S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-7-[(2S)-2-(hydroxyamino)-3,3-dimethylbutanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide.
| Compound Name | (5R,8S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-7-[(2S)-2-(hydroxyamino)-3,3-dimethylbutanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide |
|---|---|
| PubChem CID | 118074845 |
| Molecular Formula | C26H42N4O5 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | (5R,8S)-N-(4-amino-1-cyclobutyl-3,4-dioxobutan-2-yl)-7-[(2S)-2-(hydroxyamino)-3,3-dimethylbutanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-8-carboxamide |
| SMILES | CC(C)(C)[C@H](NO)C(=O)N1C[C@]2(C[C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C(C)(C)C21CCC1 |
| InChI | InChI=1S/C26H42N4O5/c1-23(2,3)19(29-35)22(34)30-14-26(24(4,5)25(26)10-7-11-25)13-17(30)21(33)28-16(18(31)20(27)32)12-15-8-6-9-15/h15-17,19,29,35H,6-14H2,1-5H3,(H2,27,32)(H,28,33)/t16?,17-,19+,26+/m0/s1 |
| InChIKey | WIXPBLISDYLYJU-KMXBGRNISA-N |
| XLogP | 1.91 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|