C16H22O3 — CID 11807489
(1R,5R)-5-[2-(methoxymethoxy)ethyl]-7-methylidene-1-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one (PubChem CID 11807489) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,5R)-5-[2-(methoxymethoxy)ethyl]-7-methylidene-1-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | (1R,5R)-5-[2-(methoxymethoxy)ethyl]-7-methylidene-1-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 11807489 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1R,5R)-5-[2-(methoxymethoxy)ethyl]-7-methylidene-1-prop-2-enylbicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=CC[C@]12C[C@](CCOCOC)(C=CC1=O)CC2=C |
| InChI | InChI=1S/C16H22O3/c1-4-6-16-11-15(10-13(16)2,7-5-14(16)17)8-9-19-12-18-3/h4-5,7H,1-2,6,8-12H2,3H3/t15-,16+/m0/s1 |
| InChIKey | CHMXCMVBYUXGEJ-JKSUJKDBSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|