About 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide
2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 1180751) has the molecular formula C21H16N4OS
and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 1180751 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1sc(Nc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H16N4OS/c26-20(23-17-12-7-13-22-14-17)19-18(15-8-3-1-4-9-15)25-21(27-19)24-16-10-5-2-6-11-16/h1-14H,(H,23,26)(H,24,25) |
| InChIKey | DKLQPJVTAQCXQU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide (CID 1180751) is 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide is O=C(Nc1cccnc1)c1sc(Nc2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The InChIKey is DKLQPJVTAQCXQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4OS/c26-20(23-17-12-7-13-22-14-17)19-18(15-8-3-1-4-9-15)25-21(27-19)24-16-10-5-2-6-11-16/h1-14H,(H,23,26)(H,24,25).
What are the key properties of 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide?
2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide has a molecular weight of 372.45 g/mol, XLogP of 5.20, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-4-phenyl-N-pyridin-3-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 1180751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).