C56H42N6 — CID 118075184
2-[4-[5-[4-[4,6-bis(2-methylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-2-yl]phenyl]-4,6-bis(2-methylphenyl)-1,3,5-triazine (PubChem CID 118075184) has the molecular formula C56H42N6 and a molecular weight of 798.99 g/mol. Its IUPAC name is 2-[4-[5-[4-[4,6-bis(2-methylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-2-yl]phenyl]-4,6-bis(2-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[5-[4-[4,6-bis(2-methylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-2-yl]phenyl]-4,6-bis(2-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118075184 |
| Molecular Formula | C56H42N6 |
| Molecular Weight | 798.99 g/mol |
| Exact Mass | 798.35 |
| IUPAC Name | 2-[4-[5-[4-[4,6-bis(2-methylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-2-yl]phenyl]-4,6-bis(2-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccccc1-c1nc(-c2ccc(-c3ccc4c(-c5ccc(-c6nc(-c7ccccc7C)nc(-c7ccccc7C)n6)cc5)cccc4c3)cc2)nc(-c2ccccc2C)n1 |
| InChI | InChI=1S/C56H42N6/c1-35-14-5-9-19-45(35)53-57-51(58-54(61-53)46-20-10-6-15-36(46)2)41-28-24-39(25-29-41)43-32-33-50-44(34-43)18-13-23-49(50)40-26-30-42(31-27-40)52-59-55(47-21-11-7-16-37(47)3)62-56(60-52)48-22-12-8-17-38(48)4/h5-34H,1-4H3 |
| InChIKey | KDGMFQMQAYRBQR-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.99 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |