C18H15N3O3S2 — CID 1180754
2-[[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]amino]benzoic acid (PubChem CID 1180754) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1180754 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[[2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanyl)acetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ncnc2sc3c(c12)CCC3)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H15N3O3S2/c22-14(21-12-6-2-1-4-10(12)18(23)24)8-25-16-15-11-5-3-7-13(11)26-17(15)20-9-19-16/h1-2,4,6,9H,3,5,7-8H2,(H,21,22)(H,23,24) |
| InChIKey | QXLAQXFNVMPEEW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |