About 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene
1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene (PubChem CID 11807551) has the molecular formula C12H18F2O2S
and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene |
| PubChem CID | 11807551 |
| Molecular Formula | C12H18F2O2S |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene |
| SMILES | CCCS(=O)(=O)C1=C(C(F)F)CC(C)=C(C)C1 |
| InChI | InChI=1S/C12H18F2O2S/c1-4-5-17(15,16)11-7-9(3)8(2)6-10(11)12(13)14/h12H,4-7H2,1-3H3 |
| InChIKey | WXJQBSXOWKYTBO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene?
The IUPAC name of 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene (CID 11807551) is 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene.
What is the SMILES notation for 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene?
The canonical SMILES for 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene is CCCS(=O)(=O)C1=C(C(F)F)CC(C)=C(C)C1.
What is the InChIKey of 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene?
The InChIKey is WXJQBSXOWKYTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2O2S/c1-4-5-17(15,16)11-7-9(3)8(2)6-10(11)12(13)14/h12H,4-7H2,1-3H3.
What are the key properties of 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene?
1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene has a molecular weight of 264.34 g/mol, XLogP of 3.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-4,5-dimethyl-2-propylsulfonylcyclohexa-1,4-diene is sourced from PubChem (CID 11807551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).