About trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane
trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane (PubChem CID 11807566) has the molecular formula C11H24OS2Si
and a molecular weight of 264.53 g/mol. Its IUPAC name is trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane |
| PubChem CID | 11807566 |
| Molecular Formula | C11H24OS2Si |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane |
| SMILES | C=C(C)C(CC(SC)SC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H24OS2Si/c1-9(2)10(12-15(5,6)7)8-11(13-3)14-4/h10-11H,1,8H2,2-7H3 |
| InChIKey | LFMSGMWOQWXSSU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane?
The IUPAC name of trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane (CID 11807566) is trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane.
What is the SMILES notation for trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane?
The canonical SMILES for trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane is C=C(C)C(CC(SC)SC)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane?
The InChIKey is LFMSGMWOQWXSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24OS2Si/c1-9(2)10(12-15(5,6)7)8-11(13-3)14-4/h10-11H,1,8H2,2-7H3.
What are the key properties of trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane?
trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane has a molecular weight of 264.53 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-methyl-5,5-bis(methylsulfanyl)pent-1-en-3-yl]oxysilane is sourced from PubChem (CID 11807566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).