About N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide
N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide (PubChem CID 118077980) has the molecular formula C7H7N3O2S2
and a molecular weight of 229.29 g/mol. Its IUPAC name is N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide.
Molecular Properties
| Compound Name | N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide |
| PubChem CID | 118077980 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide |
| SMILES | O=S(=O)(Nc1cscn1)n1cccc1 |
| InChI | InChI=1S/C7H7N3O2S2/c11-14(12,10-3-1-2-4-10)9-7-5-13-6-8-7/h1-6,9H |
| InChIKey | NFCKGLGZXCYYAP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide?
The IUPAC name of N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide (CID 118077980) is N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide.
What is the SMILES notation for N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide?
The canonical SMILES for N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide is O=S(=O)(Nc1cscn1)n1cccc1.
What is the InChIKey of N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide?
The InChIKey is NFCKGLGZXCYYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S2/c11-14(12,10-3-1-2-4-10)9-7-5-13-6-8-7/h1-6,9H.
What are the key properties of N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide?
N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide has a molecular weight of 229.29 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-thiazol-4-yl)pyrrole-1-sulfonamide is sourced from PubChem (CID 118077980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).