C23H32O4 — CID 118078814
2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxypropanoic acid (PubChem CID 118078814) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxypropanoic acid.
| Compound Name | 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 118078814 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]oxypropanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OC(C)C(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H32O4/c1-16(12-13-20-18(3)11-8-14-23(20,5)6)9-7-10-17(2)15-21(24)27-19(4)22(25)26/h7,9-10,12-13,15,19H,8,11,14H2,1-6H3,(H,25,26)/b10-7+,13-12+,16-9+,17-15+ |
| InChIKey | WJPJGOUUSADBGT-DXYSAURFSA-N |
| XLogP | 5.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|