About (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline
(2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 118078848) has the molecular formula C16H16BrFN2
and a molecular weight of 335.22 g/mol. Its IUPAC name is (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 118078848 |
| Molecular Formula | C16H16BrFN2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | C[C@H]1CN(Cc2ccccc2F)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C16H16BrFN2/c1-11-9-20(10-12-4-2-3-5-14(12)18)16-8-13(17)6-7-15(16)19-11/h2-8,11,19H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | WNVNYFJXUZBUSP-NSHDSACASA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline (CID 118078848) is (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline is C[C@H]1CN(Cc2ccccc2F)c2cc(Br)ccc2N1.
What is the InChIKey of (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline?
The InChIKey is WNVNYFJXUZBUSP-NSHDSACASA-N. The full InChI is InChI=1S/C16H16BrFN2/c1-11-9-20(10-12-4-2-3-5-14(12)18)16-8-13(17)6-7-15(16)19-11/h2-8,11,19H,9-10H2,1H3/t11-/m0/s1.
What are the key properties of (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline?
(2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline has a molecular weight of 335.22 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-bromo-4-[(2-fluorophenyl)methyl]-2-methyl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 118078848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).