About 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde
5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde (PubChem CID 11807891) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde.
Molecular Properties
| Compound Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde |
| PubChem CID | 11807891 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde |
| SMILES | Cc1c2ccncc2c(C)c2c1[nH]c1ccc(C=O)cc12 |
| InChI | InChI=1S/C18H14N2O/c1-10-15-8-19-6-5-13(15)11(2)18-17(10)14-7-12(9-21)3-4-16(14)20-18/h3-9,20H,1-2H3 |
| InChIKey | AYMPHBNENQLEHF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde?
The IUPAC name of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde (CID 11807891) is 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde.
What is the SMILES notation for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde?
The canonical SMILES for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde is Cc1c2ccncc2c(C)c2c1[nH]c1ccc(C=O)cc12.
What is the InChIKey of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde?
The InChIKey is AYMPHBNENQLEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O/c1-10-15-8-19-6-5-13(15)11(2)18-17(10)14-7-12(9-21)3-4-16(14)20-18/h3-9,20H,1-2H3.
What are the key properties of 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde?
5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde has a molecular weight of 274.32 g/mol, XLogP of 4.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-9-carbaldehyde is sourced from PubChem (CID 11807891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).