C10H12BrN3O — CID 118079168
1-(6-bromo-2-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-1-yl)ethanone (PubChem CID 118079168) has the molecular formula C10H12BrN3O and a molecular weight of 270.13 g/mol. Its IUPAC name is 1-(6-bromo-2-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-1-yl)ethanone.
| Compound Name | 1-(6-bromo-2-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-1-yl)ethanone |
|---|---|
| PubChem CID | 118079168 |
| Molecular Formula | C10H12BrN3O |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 1-(6-bromo-2-methyl-3,4-dihydro-2H-pyrido[2,3-b]pyrazin-1-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(Br)nc2NCC1C |
| InChI | InChI=1S/C10H12BrN3O/c1-6-5-12-10-8(14(6)7(2)15)3-4-9(11)13-10/h3-4,6H,5H2,1-2H3,(H,12,13) |
| InChIKey | TYHDENDFIDTTEN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|