C17H26O3 — CID 11808037
(1S,2R,7R,9R)-2-(methoxymethoxymethyl)-1,5-dimethyl-12-methylidene-8-oxatricyclo[7.2.1.02,7]dodec-5-ene (PubChem CID 11808037) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1S,2R,7R,9R)-2-(methoxymethoxymethyl)-1,5-dimethyl-12-methylidene-8-oxatricyclo[7.2.1.02,7]dodec-5-ene.
| Compound Name | (1S,2R,7R,9R)-2-(methoxymethoxymethyl)-1,5-dimethyl-12-methylidene-8-oxatricyclo[7.2.1.02,7]dodec-5-ene |
|---|---|
| PubChem CID | 11808037 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1S,2R,7R,9R)-2-(methoxymethoxymethyl)-1,5-dimethyl-12-methylidene-8-oxatricyclo[7.2.1.02,7]dodec-5-ene |
| SMILES | C=C1[C@H]2CC[C@]1(C)[C@@]1(COCOC)CCC(C)=C[C@H]1O2 |
| InChI | InChI=1S/C17H26O3/c1-12-5-8-17(10-19-11-18-4)15(9-12)20-14-6-7-16(17,3)13(14)2/h9,14-15H,2,5-8,10-11H2,1,3-4H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | JTRGLBRJZNHUJZ-WCXIOVBPSA-N |
| XLogP | 3.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|