C17H26O3 — CID 11808039
cis-(1R,2R)-1-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-2-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 11808039) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is cis-(1R,2R)-1-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-2-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-1-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-2-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11808039 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | cis-(1R,2R)-1-(1,4-dioxaspiro[4.5]dec-6-en-6-yl)-2-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@H]1CCCC[C@]1(O)C1=CCCCC12OCCO2 |
| InChI | InChI=1S/C17H26O3/c1-13(2)14-7-3-5-9-16(14,18)15-8-4-6-10-17(15)19-11-12-20-17/h8,14,18H,1,3-7,9-12H2,2H3/t14-,16-/m1/s1 |
| InChIKey | LSQCERAEAVXDLT-GDBMZVCRSA-N |
| XLogP | 3.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|