C26H44N2O5S — CID 118080540
(4-methylcyclohexyl) (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 118080540) has the molecular formula C26H44N2O5S and a molecular weight of 496.71 g/mol. Its IUPAC name is (4-methylcyclohexyl) (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | (4-methylcyclohexyl) (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 118080540 |
| Molecular Formula | C26H44N2O5S |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | (4-methylcyclohexyl) (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)OC2CCC(C)CC2)C[C@@H]1C |
| InChI | InChI=1S/C26H44N2O5S/c1-17-5-10-22(11-6-17)33-26(30)27-16-18(2)28(19(3)29)24-14-9-21(15-25(24)27)20-7-12-23(13-8-20)34(4,31)32/h17-18,20-25H,5-16H2,1-4H3/t17?,18-,20?,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | PMNMTVYMYYQHLL-WBTYWWOGSA-N |
| XLogP | 4.39 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |