C26H44N2O5S — CID 118080541
cyclohexylmethyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 118080541) has the molecular formula C26H44N2O5S and a molecular weight of 496.71 g/mol. Its IUPAC name is cyclohexylmethyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclohexylmethyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 118080541 |
| Molecular Formula | C26H44N2O5S |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | cyclohexylmethyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)OCC2CCCCC2)C[C@@H]1C |
| InChI | InChI=1S/C26H44N2O5S/c1-18-16-27(26(30)33-17-20-7-5-4-6-8-20)25-15-22(11-14-24(25)28(18)19(2)29)21-9-12-23(13-10-21)34(3,31)32/h18,20-25H,4-17H2,1-3H3/t18-,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | BXUHFYCESDQDGW-XJQYFUBHSA-N |
| XLogP | 4.40 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |