C24H40N2O5S — CID 118080553
cyclopentyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate (PubChem CID 118080553) has the molecular formula C24H40N2O5S and a molecular weight of 468.66 g/mol. Its IUPAC name is cyclopentyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate.
| Compound Name | cyclopentyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 118080553 |
| Molecular Formula | C24H40N2O5S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | cyclopentyl (3S)-4-acetyl-3-methyl-7-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxaline-1-carboxylate |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)OC2CCCC2)C[C@@H]1C |
| InChI | InChI=1S/C24H40N2O5S/c1-16-15-25(24(28)31-20-6-4-5-7-20)23-14-19(10-13-22(23)26(16)17(2)27)18-8-11-21(12-9-18)32(3,29)30/h16,18-23H,4-15H2,1-3H3/t16-,18?,19?,21?,22?,23?/m0/s1 |
| InChIKey | HDBATVDXTSBRRZ-ZXLPQJLBSA-N |
| XLogP | 3.76 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |