C23H38N2O4S — CID 118080559
1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 118080559) has the molecular formula C23H38N2O4S and a molecular weight of 438.63 g/mol. Its IUPAC name is 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 118080559 |
| Molecular Formula | C23H38N2O4S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-[(2S)-4-(cyclobutanecarbonyl)-2-methyl-6-(4-methylsulfonylcyclohexyl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C2CCC(C3CCC(S(C)(=O)=O)CC3)CC2N(C(=O)C2CCC2)C[C@@H]1C |
| InChI | InChI=1S/C23H38N2O4S/c1-15-14-24(23(27)18-5-4-6-18)22-13-19(9-12-21(22)25(15)16(2)26)17-7-10-20(11-8-17)30(3,28)29/h15,17-22H,4-14H2,1-3H3/t15-,17?,19?,20?,21?,22?/m0/s1 |
| InChIKey | ZYILGWUPIYZZOC-YILZZFIWSA-N |
| XLogP | 3.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |