6-bromo-2,3-dimethoxybenzoyl chloride

C9H8BrClO3 — CID 11808076

IUPAC6-bromo-2,3-dimethoxybenzoyl chloride
SMILESCOc1ccc(Br)c(C(=O)Cl)c1OC
InChIInChI=1S/C9H8BrClO3/c1-13-6-4-3-5(10)7(9(11)12)8(6)14-2/h3-4H,1-2H3
InChIKeySZOKVXKVDGCQGH-UHFFFAOYSA-N
MW279.52 g/mol
LogP2.85
Rot. Bonds3

About 6-bromo-2,3-dimethoxybenzoyl chloride

6-bromo-2,3-dimethoxybenzoyl chloride (PubChem CID 11808076) has the molecular formula C9H8BrClO3 and a molecular weight of 279.52 g/mol. Its IUPAC name is 6-bromo-2,3-dimethoxybenzoyl chloride.

Molecular Properties

Compound Name6-bromo-2,3-dimethoxybenzoyl chloride
PubChem CID11808076
Molecular FormulaC9H8BrClO3
Molecular Weight279.52 g/mol
Exact Mass277.93
IUPAC Name6-bromo-2,3-dimethoxybenzoyl chloride
SMILESCOc1ccc(Br)c(C(=O)Cl)c1OC
InChIInChI=1S/C9H8BrClO3/c1-13-6-4-3-5(10)7(9(11)12)8(6)14-2/h3-4H,1-2H3
InChIKeySZOKVXKVDGCQGH-UHFFFAOYSA-N
XLogP2.85
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.52
LogP ≤ 52.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 6-bromo-2,3-dimethoxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-bromo-2,3-dimethoxybenzoyl chloride?
The IUPAC name of 6-bromo-2,3-dimethoxybenzoyl chloride (CID 11808076) is 6-bromo-2,3-dimethoxybenzoyl chloride.
What is the SMILES notation for 6-bromo-2,3-dimethoxybenzoyl chloride?
The canonical SMILES for 6-bromo-2,3-dimethoxybenzoyl chloride is COc1ccc(Br)c(C(=O)Cl)c1OC.
What is the InChIKey of 6-bromo-2,3-dimethoxybenzoyl chloride?
The InChIKey is SZOKVXKVDGCQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClO3/c1-13-6-4-3-5(10)7(9(11)12)8(6)14-2/h3-4H,1-2H3.
What are the key properties of 6-bromo-2,3-dimethoxybenzoyl chloride?
6-bromo-2,3-dimethoxybenzoyl chloride has a molecular weight of 279.52 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dimethoxybenzoyl chloride is sourced from PubChem (CID 11808076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).