C19H23NO3 — CID 118081120
(7'aS,12'bR)-9'-methylspiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] (PubChem CID 118081120) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (7'aS,12'bR)-9'-methylspiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline].
| Compound Name | (7'aS,12'bR)-9'-methylspiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] |
|---|---|
| PubChem CID | 118081120 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (7'aS,12'bR)-9'-methylspiro[1,3-dioxolane-2,7'-2,3,4,4a,5,6,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline] |
| SMILES | Cc1ccc2c3c1O[C@@H]1C4(CCC5C(C2)NCC[C@]351)OCCO4 |
| InChI | InChI=1S/C19H23NO3/c1-11-2-3-12-10-14-13-4-5-19(21-8-9-22-19)17-18(13,6-7-20-14)15(12)16(11)23-17/h2-3,13-14,17,20H,4-10H2,1H3/t13?,14?,17-,18+/m0/s1 |
| InChIKey | ZWVKESWOQUVMDH-JOCCRWCTSA-N |
| XLogP | 2.06 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |