C53H45NS2 — CID 118081420
2,4-bis(5,5,8,8-tetramethylindeno[2,1-c]thioxanthen-10-yl)pyridine (PubChem CID 118081420) has the molecular formula C53H45NS2 and a molecular weight of 760.08 g/mol. Its IUPAC name is 2,4-bis(5,5,8,8-tetramethylindeno[2,1-c]thioxanthen-10-yl)pyridine.
| Compound Name | 2,4-bis(5,5,8,8-tetramethylindeno[2,1-c]thioxanthen-10-yl)pyridine |
|---|---|
| PubChem CID | 118081420 |
| Molecular Formula | C53H45NS2 |
| Molecular Weight | 760.08 g/mol |
| Exact Mass | 759.30 |
| IUPAC Name | 2,4-bis(5,5,8,8-tetramethylindeno[2,1-c]thioxanthen-10-yl)pyridine |
| SMILES | CC1(C)c2ccccc2Sc2c1ccc1c2-c2ccc(-c3ccnc(-c4ccc5c(c4)C(C)(C)c4ccc6c(c4-5)Sc4ccccc4C6(C)C)c3)cc2C1(C)C |
| InChI | InChI=1S/C53H45NS2/c1-50(2)35-13-9-11-15-44(35)55-48-39(50)23-21-37-46(48)33-19-17-30(27-41(33)52(37,5)6)31-25-26-54-43(29-31)32-18-20-34-42(28-32)53(7,8)38-22-24-40-49(47(34)38)56-45-16-12-10-14-36(45)51(40,3)4/h9-29H,1-8H3 |
| InChIKey | AVGSTPBORZHJAD-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.08 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |