C16H26O4 — CID 11808155
methyl (1R,2S,3R,5R)-2-methyl-3-(oxan-2-yloxy)-5-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 11808155) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (1R,2S,3R,5R)-2-methyl-3-(oxan-2-yloxy)-5-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3R,5R)-2-methyl-3-(oxan-2-yloxy)-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11808155 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (1R,2S,3R,5R)-2-methyl-3-(oxan-2-yloxy)-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@@H](OC2CCCCO2)[C@@H](C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H26O4/c1-10(2)12-9-13(11(3)15(12)16(17)18-4)20-14-7-5-6-8-19-14/h11-15H,1,5-9H2,2-4H3/t11-,12+,13-,14?,15+/m1/s1 |
| InChIKey | VPQPJIBYCUCLBH-LJIAPDMLSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|