C24H28N4OS — CID 118081599
(E)-N-(3-methylpentan-2-yloxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 118081599) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is (E)-N-(3-methylpentan-2-yloxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-N-(3-methylpentan-2-yloxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 118081599 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-N-(3-methylpentan-2-yloxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | CCC(C)C(C)O/N=C1\CCCc2ccc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C24H28N4OS/c1-5-15(2)17(4)29-28-20-10-6-8-18-11-12-21(27-22(18)20)23-16(3)26-24(30-23)19-9-7-13-25-14-19/h7,9,11-15,17H,5-6,8,10H2,1-4H3/b28-20+ |
| InChIKey | ZMZHQMKIEHDNEU-VFCFBJKWSA-N |
| XLogP | 6.07 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|