C21H20F2N4OS — CID 118081603
(E)-N-(2,2-difluoropropoxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 118081603) has the molecular formula C21H20F2N4OS and a molecular weight of 414.48 g/mol. Its IUPAC name is (E)-N-(2,2-difluoropropoxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-N-(2,2-difluoropropoxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 118081603 |
| Molecular Formula | C21H20F2N4OS |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (E)-N-(2,2-difluoropropoxy)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | Cc1nc(-c2cccnc2)sc1-c1ccc2c(n1)/C(=N/OCC(C)(F)F)CCC2 |
| InChI | InChI=1S/C21H20F2N4OS/c1-13-19(29-20(25-13)15-6-4-10-24-11-15)17-9-8-14-5-3-7-16(18(14)26-17)27-28-12-21(2,22)23/h4,6,8-11H,3,5,7,12H2,1-2H3/b27-16+ |
| InChIKey | DJNDKTMYMMILEL-JVWAILMASA-N |
| XLogP | 5.29 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|