C16H13N5O2S — CID 118081610
(E)-N-methoxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine (PubChem CID 118081610) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is (E)-N-methoxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine.
| Compound Name | (E)-N-methoxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
|---|---|
| PubChem CID | 118081610 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (E)-N-methoxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
| SMILES | CO/N=C1\CCOc2ncc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C16H13N5O2S/c1-22-21-11-4-6-23-15-14(11)20-12(8-18-15)13-9-19-16(24-13)10-3-2-5-17-7-10/h2-3,5,7-9H,4,6H2,1H3/b21-11+ |
| InChIKey | FGJYUXYKBSEYLQ-SRZZPIQSSA-N |
| XLogP | 2.80 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|