C18H17N5O2S — CID 118081611
(E)-N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine (PubChem CID 118081611) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is (E)-N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine.
| Compound Name | (E)-N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
|---|---|
| PubChem CID | 118081611 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (E)-N-propan-2-yloxy-2-(2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
| SMILES | CC(C)O/N=C1\CCOc2ncc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C18H17N5O2S/c1-11(2)25-23-13-5-7-24-17-16(13)22-14(9-20-17)15-10-21-18(26-15)12-4-3-6-19-8-12/h3-4,6,8-11H,5,7H2,1-2H3/b23-13+ |
| InChIKey | FBPYSNKEADTSNW-YDZHTSKRSA-N |
| XLogP | 3.57 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|