C19H19N5O2S — CID 118081639
(E)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propan-2-yloxy-6,7-dihydropyrano[2,3-b]pyrazin-8-imine (PubChem CID 118081639) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is (E)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propan-2-yloxy-6,7-dihydropyrano[2,3-b]pyrazin-8-imine.
| Compound Name | (E)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propan-2-yloxy-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
|---|---|
| PubChem CID | 118081639 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (E)-2-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-N-propan-2-yloxy-6,7-dihydropyrano[2,3-b]pyrazin-8-imine |
| SMILES | Cc1nc(-c2cccnc2)sc1-c1cnc2c(n1)/C(=N/OC(C)C)CCO2 |
| InChI | InChI=1S/C19H19N5O2S/c1-11(2)26-24-14-6-8-25-18-16(14)23-15(10-21-18)17-12(3)22-19(27-17)13-5-4-7-20-9-13/h4-5,7,9-11H,6,8H2,1-3H3/b24-14+ |
| InChIKey | HQHILPIHZSSWAM-ZVHZXABRSA-N |
| XLogP | 3.88 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|