C18H18N6OS — CID 118081707
(E)-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine (PubChem CID 118081707) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is (E)-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine.
| Compound Name | (E)-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine |
|---|---|
| PubChem CID | 118081707 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (E)-N-propan-2-yloxy-3-(2-pyridin-3-yl-1,3-thiazol-5-yl)-7,8-dihydro-6H-1,2,4-benzotriazin-5-imine |
| SMILES | CC(C)O/N=C1\CCCc2nnc(-c3cnc(-c4cccnc4)s3)nc21 |
| InChI | InChI=1S/C18H18N6OS/c1-11(2)25-24-14-7-3-6-13-16(14)21-17(23-22-13)15-10-20-18(26-15)12-5-4-8-19-9-12/h4-5,8-11H,3,6-7H2,1-2H3/b24-14+ |
| InChIKey | ZOXJNJPPDQEFAD-ZVHZXABRSA-N |
| XLogP | 3.52 |
| TPSA | 86.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|