C18H19N7OS — CID 118081741
(E)-N-ethoxy-8-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine (PubChem CID 118081741) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is (E)-N-ethoxy-8-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine.
| Compound Name | (E)-N-ethoxy-8-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine |
|---|---|
| PubChem CID | 118081741 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (E)-N-ethoxy-8-methyl-3-(4-methyl-2-pyridin-3-yl-1,3-thiazol-5-yl)-6,7-dihydropyrido[3,2-e][1,2,4]triazin-5-imine |
| SMILES | CCO/N=C1\CCN(C)c2nnc(-c3sc(-c4cccnc4)nc3C)nc21 |
| InChI | InChI=1S/C18H19N7OS/c1-4-26-24-13-7-9-25(3)17-14(13)21-16(22-23-17)15-11(2)20-18(27-15)12-6-5-8-19-10-12/h5-6,8,10H,4,7,9H2,1-3H3/b24-13+ |
| InChIKey | JHSRMYKVWPOUOP-ZMOGYAJESA-N |
| XLogP | 2.95 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|