C41H41N3OS — CID 118081918
2-[(3E,5Z)-7-[1-[2,6-di(propan-2-yl)phenyl]imidazol-4-yl]octa-3,5,7-trien-3-yl]oxy-6-(3-methyldibenzothiophen-4-yl)pyridine (PubChem CID 118081918) has the molecular formula C41H41N3OS and a molecular weight of 623.87 g/mol. Its IUPAC name is 2-[(3E,5Z)-7-[1-[2,6-di(propan-2-yl)phenyl]imidazol-4-yl]octa-3,5,7-trien-3-yl]oxy-6-(3-methyldibenzothiophen-4-yl)pyridine.
| Compound Name | 2-[(3E,5Z)-7-[1-[2,6-di(propan-2-yl)phenyl]imidazol-4-yl]octa-3,5,7-trien-3-yl]oxy-6-(3-methyldibenzothiophen-4-yl)pyridine |
|---|---|
| PubChem CID | 118081918 |
| Molecular Formula | C41H41N3OS |
| Molecular Weight | 623.87 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 2-[(3E,5Z)-7-[1-[2,6-di(propan-2-yl)phenyl]imidazol-4-yl]octa-3,5,7-trien-3-yl]oxy-6-(3-methyldibenzothiophen-4-yl)pyridine |
| SMILES | C=C(/C=C\C=C(/CC)Oc1cccc(-c2c(C)ccc3c2sc2ccccc23)n1)c1cn(-c2c(C(C)C)cccc2C(C)C)cn1 |
| InChI | InChI=1S/C41H41N3OS/c1-8-30(15-11-14-28(6)36-24-44(25-42-36)40-31(26(2)3)17-12-18-32(40)27(4)5)45-38-21-13-19-35(43-38)39-29(7)22-23-34-33-16-9-10-20-37(33)46-41(34)39/h9-27H,6,8H2,1-5,7H3/b14-11-,30-15+ |
| InChIKey | BBGNURNRMOCRTD-MDOANENXSA-N |
| XLogP | 11.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.87 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|