About (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate
(pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate (PubChem CID 118081942) has the molecular formula C15H23NO3S
and a molecular weight of 297.42 g/mol. Its IUPAC name is (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate.
Molecular Properties
| Compound Name | (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate |
| PubChem CID | 118081942 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate |
| SMILES | CCCC(C)=NOS(=O)(=O)c1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-5-7-13(4)16-19-20(17,18)15-10-8-14(9-11-15)12(3)6-2/h8-12H,5-7H2,1-4H3 |
| InChIKey | XDCSEVKHARMZDY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate?
The IUPAC name of (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate (CID 118081942) is (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate.
What is the SMILES notation for (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate?
The canonical SMILES for (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate is CCCC(C)=NOS(=O)(=O)c1ccc(C(C)CC)cc1.
What is the InChIKey of (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate?
The InChIKey is XDCSEVKHARMZDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3S/c1-5-7-13(4)16-19-20(17,18)15-10-8-14(9-11-15)12(3)6-2/h8-12H,5-7H2,1-4H3.
What are the key properties of (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate?
(pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate has a molecular weight of 297.42 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (pentan-2-ylideneamino) 4-butan-2-ylbenzenesulfonate is sourced from PubChem (CID 118081942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).