C32H42O3 — CID 118082440
5-ethyl-6-[[5-methyl-4-oxo-8-(3-propylphenyl)-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione (PubChem CID 118082440) has the molecular formula C32H42O3 and a molecular weight of 474.69 g/mol. Its IUPAC name is 5-ethyl-6-[[5-methyl-4-oxo-8-(3-propylphenyl)-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione.
| Compound Name | 5-ethyl-6-[[5-methyl-4-oxo-8-(3-propylphenyl)-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione |
|---|---|
| PubChem CID | 118082440 |
| Molecular Formula | C32H42O3 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 5-ethyl-6-[[5-methyl-4-oxo-8-(3-propylphenyl)-2,3-dihydro-1H-naphthalen-2-yl]methyl]nonane-2,4-dione |
| SMILES | CCCc1cccc(-c2ccc(C)c3c2CC(CC(CCC)C(CC)C(=O)CC(C)=O)CC3=O)c1 |
| InChI | InChI=1S/C32H42O3/c1-6-10-23-12-9-13-26(17-23)28-15-14-21(4)32-29(28)19-24(20-31(32)35)18-25(11-7-2)27(8-3)30(34)16-22(5)33/h9,12-15,17,24-25,27H,6-8,10-11,16,18-20H2,1-5H3 |
| InChIKey | CIEHKZNUVDJWHF-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|