C29H44N2O6 — CID 118083398
8-hydroxy-5-(hydroxymethyl)-6-[[5-hydroxy-4-oxo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,3-dihydro-1H-naphthalen-2-yl]methyl]octane-2,4-dione (PubChem CID 118083398) has the molecular formula C29H44N2O6 and a molecular weight of 516.68 g/mol. Its IUPAC name is 8-hydroxy-5-(hydroxymethyl)-6-[[5-hydroxy-4-oxo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,3-dihydro-1H-naphthalen-2-yl]methyl]octane-2,4-dione.
| Compound Name | 8-hydroxy-5-(hydroxymethyl)-6-[[5-hydroxy-4-oxo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,3-dihydro-1H-naphthalen-2-yl]methyl]octane-2,4-dione |
|---|---|
| PubChem CID | 118083398 |
| Molecular Formula | C29H44N2O6 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 8-hydroxy-5-(hydroxymethyl)-6-[[5-hydroxy-4-oxo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2,3-dihydro-1H-naphthalen-2-yl]methyl]octane-2,4-dione |
| SMILES | CC(=O)CC(=O)C(CO)C(CCO)CC1CC(=O)c2c(ccc(NC3CC(C)(C)NC(C)(C)C3)c2O)C1 |
| InChI | InChI=1S/C29H44N2O6/c1-17(34)10-24(35)22(16-33)19(8-9-32)11-18-12-20-6-7-23(27(37)26(20)25(36)13-18)30-21-14-28(2,3)31-29(4,5)15-21/h6-7,18-19,21-22,30-33,37H,8-16H2,1-5H3 |
| InChIKey | KVPJDJSTLIMTSS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|