About 3-(methylamino)-1,2-dihydropyridin-2-ol
3-(methylamino)-1,2-dihydropyridin-2-ol (PubChem CID 118083871) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 3-(methylamino)-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 3-(methylamino)-1,2-dihydropyridin-2-ol |
| PubChem CID | 118083871 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 3-(methylamino)-1,2-dihydropyridin-2-ol |
| SMILES | CNC1=CC=CNC1O |
| InChI | InChI=1S/C6H10N2O/c1-7-5-3-2-4-8-6(5)9/h2-4,6-9H,1H3 |
| InChIKey | JLAYYWVONUKXLV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methylamino)-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)-1,2-dihydropyridin-2-ol?
The IUPAC name of 3-(methylamino)-1,2-dihydropyridin-2-ol (CID 118083871) is 3-(methylamino)-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 3-(methylamino)-1,2-dihydropyridin-2-ol?
The canonical SMILES for 3-(methylamino)-1,2-dihydropyridin-2-ol is CNC1=CC=CNC1O.
What is the InChIKey of 3-(methylamino)-1,2-dihydropyridin-2-ol?
The InChIKey is JLAYYWVONUKXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-7-5-3-2-4-8-6(5)9/h2-4,6-9H,1H3.
What are the key properties of 3-(methylamino)-1,2-dihydropyridin-2-ol?
3-(methylamino)-1,2-dihydropyridin-2-ol has a molecular weight of 126.16 g/mol, XLogP of -0.47, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 118083871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).