C19H30O2 — CID 11808424
5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane (PubChem CID 11808424) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane.
| Compound Name | 5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane |
|---|---|
| PubChem CID | 11808424 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 5-(2-tert-butylhexa-2,3-dienyl)-2,2-dimethyl-5-prop-2-ynyl-1,3-dioxane |
| SMILES | C#CCC1(CC(=C=CCC)C(C)(C)C)COC(C)(C)OC1 |
| InChI | InChI=1S/C19H30O2/c1-8-10-11-16(17(3,4)5)13-19(12-9-2)14-20-18(6,7)21-15-19/h2,10H,8,12-15H2,1,3-7H3 |
| InChIKey | IUNKRRSHBTVPFC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|