About 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine
4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine (PubChem CID 118084479) has the molecular formula C14H26FNO
and a molecular weight of 243.37 g/mol. Its IUPAC name is 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine.
Molecular Properties
| Compound Name | 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine |
| PubChem CID | 118084479 |
| Molecular Formula | C14H26FNO |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine |
| SMILES | CC(C)(C)C1CCN([C@H]2CCOC[C@H]2F)CC1 |
| InChI | InChI=1S/C14H26FNO/c1-14(2,3)11-4-7-16(8-5-11)13-6-9-17-10-12(13)15/h11-13H,4-10H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | RVAWKLLHLHRBSS-OLZOCXBDSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine?
The IUPAC name of 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine (CID 118084479) is 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine.
What is the SMILES notation for 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine?
The canonical SMILES for 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine is CC(C)(C)C1CCN([C@H]2CCOC[C@H]2F)CC1.
What is the InChIKey of 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine?
The InChIKey is RVAWKLLHLHRBSS-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H26FNO/c1-14(2,3)11-4-7-16(8-5-11)13-6-9-17-10-12(13)15/h11-13H,4-10H2,1-3H3/t12-,13+/m1/s1.
What are the key properties of 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine?
4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine has a molecular weight of 243.37 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-[(3S,4S)-3-fluorooxan-4-yl]piperidine is sourced from PubChem (CID 118084479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).