C35H65NO2 — CID 118084777
[(Z)-non-2-enyl] 8-[[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate (PubChem CID 118084777) has the molecular formula C35H65NO2 and a molecular weight of 531.91 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate |
|---|---|
| PubChem CID | 118084777 |
| Molecular Formula | C35H65NO2 |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.50 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[[(8Z,11Z)-octadeca-8,11-dienyl]amino]octanoate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCNCCCCCCCC(=O)OC/C=C\CCCCCC |
| InChI | InChI=1S/C35H65NO2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-24-28-32-36-33-29-25-22-23-27-31-35(37)38-34-30-26-21-10-8-6-4-2/h12-13,15-16,26,30,36H,3-11,14,17-25,27-29,31-34H2,1-2H3/b13-12-,16-15-,30-26- |
| InChIKey | VXLONNYLDVUHPZ-VZJUUCKGSA-N |
| XLogP | 10.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|