About 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile
3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile (PubChem CID 118084893) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile.
Molecular Properties
| Compound Name | 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile |
| PubChem CID | 118084893 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile |
| SMILES | CCC(CC#N)C1N=C(C)C(=O)O1 |
| InChI | InChI=1S/C9H12N2O2/c1-3-7(4-5-10)8-11-6(2)9(12)13-8/h7-8H,3-4H2,1-2H3 |
| InChIKey | OAEJDSSBIJCYMD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile?
The IUPAC name of 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile (CID 118084893) is 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile.
What is the SMILES notation for 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile?
The canonical SMILES for 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile is CCC(CC#N)C1N=C(C)C(=O)O1.
What is the InChIKey of 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile?
The InChIKey is OAEJDSSBIJCYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-3-7(4-5-10)8-11-6(2)9(12)13-8/h7-8H,3-4H2,1-2H3.
What are the key properties of 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile?
3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile has a molecular weight of 180.21 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-5-oxo-2H-1,3-oxazol-2-yl)pentanenitrile is sourced from PubChem (CID 118084893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).