C23H19ClN6O3 — CID 118085407
(2R,6S)-11-(3-chlorophenyl)-7-N-(4-cyanophenyl)-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7,10-dicarboxamide (PubChem CID 118085407) has the molecular formula C23H19ClN6O3 and a molecular weight of 462.90 g/mol. Its IUPAC name is (2R,6S)-11-(3-chlorophenyl)-7-N-(4-cyanophenyl)-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7,10-dicarboxamide.
| Compound Name | (2R,6S)-11-(3-chlorophenyl)-7-N-(4-cyanophenyl)-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7,10-dicarboxamide |
|---|---|
| PubChem CID | 118085407 |
| Molecular Formula | C23H19ClN6O3 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (2R,6S)-11-(3-chlorophenyl)-7-N-(4-cyanophenyl)-4-oxa-1,7,12-triazatricyclo[7.3.0.02,6]dodeca-9,11-diene-7,10-dicarboxamide |
| SMILES | N#Cc1ccc(NC(=O)N2Cc3c(C(N)=O)c(-c4cccc(Cl)c4)nn3[C@H]3COC[C@H]32)cc1 |
| InChI | InChI=1S/C23H19ClN6O3/c24-15-3-1-2-14(8-15)21-20(22(26)31)17-10-29(18-11-33-12-19(18)30(17)28-21)23(32)27-16-6-4-13(9-25)5-7-16/h1-8,18-19H,10-12H2,(H2,26,31)(H,27,32)/t18-,19+/m1/s1 |
| InChIKey | JEOQBORVNWSXTE-MOPGFXCFSA-N |
| XLogP | 3.16 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |