C16H26O3Si — CID 11808545
(3S,3aS,6aS)-5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3-methyl-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 11808545) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3-methyl-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aS,6aS)-5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3-methyl-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 11808545 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (3S,3aS,6aS)-5-[1-[tert-butyl(dimethyl)silyl]oxyethenyl]-3-methyl-3,3a,6,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C1=C[C@@H]2[C@H](C1)OC(=O)[C@H]2C |
| InChI | InChI=1S/C16H26O3Si/c1-10-13-8-12(9-14(13)18-15(10)17)11(2)19-20(6,7)16(3,4)5/h8,10,13-14H,2,9H2,1,3-7H3/t10-,13-,14-/m0/s1 |
| InChIKey | BGSCFIIZNPGXFP-BPNCWPANSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|