C21H16F5N7O2 — CID 118085618
2-(3,4-difluorophenyl)-3-N-hydrazinylidene-5-N-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 118085618) has the molecular formula C21H16F5N7O2 and a molecular weight of 493.40 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-N-hydrazinylidene-5-N-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | 2-(3,4-difluorophenyl)-3-N-hydrazinylidene-5-N-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 118085618 |
| Molecular Formula | C21H16F5N7O2 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-N-hydrazinylidene-5-N-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | N/N=N/C(=O)c1c(-c2ccc(F)c(F)c2)nn2c1CN(C(=O)Nc1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C21H16F5N7O2/c22-14-6-1-11(9-15(14)23)18-17(19(34)29-31-27)16-10-32(7-8-33(16)30-18)20(35)28-13-4-2-12(3-5-13)21(24,25)26/h1-6,9H,7-8,10H2,(H,28,35)(H2,27,29,34) |
| InChIKey | GAVGEVCNDFTZKR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|