C11H21NO6S — CID 11808563
[(4R,5S)-2,2-dimethyl-4-(pyrrolidin-1-ium-1-ylmethyl)-1,3-dioxan-5-yl] sulfate (PubChem CID 11808563) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is [(4R,5S)-2,2-dimethyl-4-(pyrrolidin-1-ium-1-ylmethyl)-1,3-dioxan-5-yl] sulfate.
| Compound Name | [(4R,5S)-2,2-dimethyl-4-(pyrrolidin-1-ium-1-ylmethyl)-1,3-dioxan-5-yl] sulfate |
|---|---|
| PubChem CID | 11808563 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | [(4R,5S)-2,2-dimethyl-4-(pyrrolidin-1-ium-1-ylmethyl)-1,3-dioxan-5-yl] sulfate |
| SMILES | CC1(C)OC[C@H](OS(=O)(=O)[O-])[C@@H](C[NH+]2CCCC2)O1 |
| InChI | InChI=1S/C11H21NO6S/c1-11(2)16-8-10(18-19(13,14)15)9(17-11)7-12-5-3-4-6-12/h9-10H,3-8H2,1-2H3,(H,13,14,15)/t9-,10+/m1/s1 |
| InChIKey | CXDNXOCZMLLLIY-ZJUUUORDSA-N |
| XLogP | -1.34 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|