C13H17N3O3S — CID 11808570
(2R,10'aR)-2'-methylspiro[1,3-oxathiolane-2,7'-8,9,10,10a-tetrahydro-5H-[1,2,4]triazolo[1,2-a]cinnoline]-1',3'-dione (PubChem CID 11808570) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (2R,10'aR)-2'-methylspiro[1,3-oxathiolane-2,7'-8,9,10,10a-tetrahydro-5H-[1,2,4]triazolo[1,2-a]cinnoline]-1',3'-dione.
| Compound Name | (2R,10'aR)-2'-methylspiro[1,3-oxathiolane-2,7'-8,9,10,10a-tetrahydro-5H-[1,2,4]triazolo[1,2-a]cinnoline]-1',3'-dione |
|---|---|
| PubChem CID | 11808570 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2R,10'aR)-2'-methylspiro[1,3-oxathiolane-2,7'-8,9,10,10a-tetrahydro-5H-[1,2,4]triazolo[1,2-a]cinnoline]-1',3'-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1CCC[C@]3(OCCS3)C1=CC2 |
| InChI | InChI=1S/C13H17N3O3S/c1-14-11(17)15-6-4-9-10(16(15)12(14)18)3-2-5-13(9)19-7-8-20-13/h4,10H,2-3,5-8H2,1H3/t10-,13-/m1/s1 |
| InChIKey | WPJFKJJFTWLJBN-ZWNOBZJWSA-N |
| XLogP | 0.47 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|