C24H36O4 — CID 118085888
(4R,6S)-4-[[(4R,6R)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane (PubChem CID 118085888) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (4R,6S)-4-[[(4R,6R)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-[[(4R,6R)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 118085888 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4R,6S)-4-[[(4R,6R)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-6-ethenyl-2,2-dimethyl-1,3-dioxane |
| SMILES | C=C[C@@H]1C[C@@H](C[C@H]2C[C@@H](CCCc3ccccc3)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C24H36O4/c1-6-19-15-21(27-23(2,3)25-19)17-22-16-20(26-24(4,5)28-22)14-10-13-18-11-8-7-9-12-18/h6-9,11-12,19-22H,1,10,13-17H2,2-5H3/t19-,20-,21+,22-/m1/s1 |
| InChIKey | OTLIRERQLVKKMM-YUMYIRISSA-N |
| XLogP | 5.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|