C23H34O5 — CID 118086012
(4R,6S)-6-[[(4R,6S)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde (PubChem CID 118086012) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (4R,6S)-6-[[(4R,6S)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (4R,6S)-6-[[(4R,6S)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 118086012 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (4R,6S)-6-[[(4R,6S)-2,2-dimethyl-6-(3-phenylpropyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CC1(C)O[C@@H](C[C@H]2C[C@H](C=O)OC(C)(C)O2)C[C@H](CCCc2ccccc2)O1 |
| InChI | InChI=1S/C23H34O5/c1-22(2)25-18(12-8-11-17-9-6-5-7-10-17)13-19(26-22)14-20-15-21(16-24)28-23(3,4)27-20/h5-7,9-10,16,18-21H,8,11-15H2,1-4H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | FUCWSQPYQKCJJK-JSXRDJHFSA-N |
| XLogP | 4.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|