C24H29N3O — CID 118086016
1-[6-(aminomethyl)-2-methyl-1-(4-methylphenyl)indol-3-yl]-2-piperidin-1-ylethanone (PubChem CID 118086016) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[6-(aminomethyl)-2-methyl-1-(4-methylphenyl)indol-3-yl]-2-piperidin-1-ylethanone.
| Compound Name | 1-[6-(aminomethyl)-2-methyl-1-(4-methylphenyl)indol-3-yl]-2-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 118086016 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[6-(aminomethyl)-2-methyl-1-(4-methylphenyl)indol-3-yl]-2-piperidin-1-ylethanone |
| SMILES | Cc1ccc(-n2c(C)c(C(=O)CN3CCCCC3)c3ccc(CN)cc32)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-17-6-9-20(10-7-17)27-18(2)24(21-11-8-19(15-25)14-22(21)27)23(28)16-26-12-4-3-5-13-26/h6-11,14H,3-5,12-13,15-16,25H2,1-2H3 |
| InChIKey | UICAWMQSIHBVTF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |