C19H34O4 — CID 118086128
(4R,6S)-4-butyl-6-[[(4S,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 118086128) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (4R,6S)-4-butyl-6-[[(4S,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-butyl-6-[[(4S,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 118086128 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (4R,6S)-4-butyl-6-[[(4S,6S)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | C=C[C@@H]1C[C@H](C[C@@H]2C[C@@H](CCCC)OC(C)(C)O2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H34O4/c1-7-9-10-15-12-17(23-19(5,6)21-15)13-16-11-14(8-2)20-18(3,4)22-16/h8,14-17H,2,7,9-13H2,1,3-6H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | DDZLMCSURYVZKF-VQHPVUNQSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|