About (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline
(2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline (PubChem CID 118086217) has the molecular formula C17H18BrNO
and a molecular weight of 332.24 g/mol. Its IUPAC name is (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline |
| PubChem CID | 118086217 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline |
| SMILES | C[C@H]1CCc2c(ccc(Br)c2Oc2ccccc2)N1C |
| InChI | InChI=1S/C17H18BrNO/c1-12-8-9-14-16(19(12)2)11-10-15(18)17(14)20-13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | LCFGTWHBMNIQFD-LBPRGKRZSA-N |
| XLogP | 5.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline?
The IUPAC name of (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline (CID 118086217) is (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline.
What is the SMILES notation for (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline?
The canonical SMILES for (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline is C[C@H]1CCc2c(ccc(Br)c2Oc2ccccc2)N1C.
What is the InChIKey of (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline?
The InChIKey is LCFGTWHBMNIQFD-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H18BrNO/c1-12-8-9-14-16(19(12)2)11-10-15(18)17(14)20-13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3/t12-/m0/s1.
What are the key properties of (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline?
(2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline has a molecular weight of 332.24 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-bromo-1,2-dimethyl-5-phenoxy-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 118086217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).